C10H11BrN2O — CID 82232637
(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)methanamine (PubChem CID 82232637) has the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. Its IUPAC name is (7-bromo-5-ethyl-1,3-benzoxazol-2-yl)methanamine.
| Compound Name | (7-bromo-5-ethyl-1,3-benzoxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 82232637 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (7-bromo-5-ethyl-1,3-benzoxazol-2-yl)methanamine |
| SMILES | CCc1cc(Br)c2oc(CN)nc2c1 |
| InChI | InChI=1S/C10H11BrN2O/c1-2-6-3-7(11)10-8(4-6)13-9(5-12)14-10/h3-4H,2,5,12H2,1H3 |
| InChIKey | BNLRKLMEFDTPIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |