C8H5BrFNO — CID 84693211
7-bromo-3-(fluoromethyl)-1,2-benzoxazole (PubChem CID 84693211) has the molecular formula C8H5BrFNO and a molecular weight of 230.04 g/mol. Its IUPAC name is 7-bromo-3-(fluoromethyl)-1,2-benzoxazole.
| Compound Name | 7-bromo-3-(fluoromethyl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 84693211 |
| Molecular Formula | C8H5BrFNO |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 7-bromo-3-(fluoromethyl)-1,2-benzoxazole |
| SMILES | FCc1noc2c(Br)cccc12 |
| InChI | InChI=1S/C8H5BrFNO/c9-6-3-1-2-5-7(4-10)11-12-8(5)6/h1-3H,4H2 |
| InChIKey | QPCVAGQCCXURDV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |