C14H16BrN3O3S — CID 138519042
1-(7-bromo-1,2-benzoxazol-3-yl)-N-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)oxysulfanyl]-N-methylmethanamine (PubChem CID 138519042) has the molecular formula C14H16BrN3O3S and a molecular weight of 386.27 g/mol. Its IUPAC name is 1-(7-bromo-1,2-benzoxazol-3-yl)-N-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)oxysulfanyl]-N-methylmethanamine.
| Compound Name | 1-(7-bromo-1,2-benzoxazol-3-yl)-N-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)oxysulfanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 138519042 |
| Molecular Formula | C14H16BrN3O3S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 1-(7-bromo-1,2-benzoxazol-3-yl)-N-[(5,5-dimethyl-4H-1,2-oxazol-3-yl)oxysulfanyl]-N-methylmethanamine |
| SMILES | CN(Cc1noc2c(Br)cccc12)SOC1=NOC(C)(C)C1 |
| InChI | InChI=1S/C14H16BrN3O3S/c1-14(2)7-12(17-21-14)20-22-18(3)8-11-9-5-4-6-10(15)13(9)19-16-11/h4-6H,7-8H2,1-3H3 |
| InChIKey | VWAJOHMUCXGFIW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|