About 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole
7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole (PubChem CID 84711773) has the molecular formula C11H11BrN2O
and a molecular weight of 267.13 g/mol. Its IUPAC name is 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole |
| PubChem CID | 84711773 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole |
| SMILES | Brc1cccc2c(C3CCNC3)noc12 |
| InChI | InChI=1S/C11H11BrN2O/c12-9-3-1-2-8-10(14-15-11(8)9)7-4-5-13-6-7/h1-3,7,13H,4-6H2 |
| InChIKey | QXEKIDPJFXCHJT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole?
The IUPAC name of 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole (CID 84711773) is 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole.
What is the SMILES notation for 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole?
The canonical SMILES for 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole is Brc1cccc2c(C3CCNC3)noc12.
What is the InChIKey of 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole?
The InChIKey is QXEKIDPJFXCHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O/c12-9-3-1-2-8-10(14-15-11(8)9)7-4-5-13-6-7/h1-3,7,13H,4-6H2.
What are the key properties of 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole?
7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole has a molecular weight of 267.13 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-pyrrolidin-3-yl-1,2-benzoxazole is sourced from PubChem (CID 84711773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).