C11H12N2O2 — CID 84672235
3-pyrrolidin-3-yl-1,2-benzoxazol-7-ol (PubChem CID 84672235) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-1,2-benzoxazol-7-ol.
| Compound Name | 3-pyrrolidin-3-yl-1,2-benzoxazol-7-ol |
|---|---|
| PubChem CID | 84672235 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-pyrrolidin-3-yl-1,2-benzoxazol-7-ol |
| SMILES | Oc1cccc2c(C3CCNC3)noc12 |
| InChI | InChI=1S/C11H12N2O2/c14-9-3-1-2-8-10(13-15-11(8)9)7-4-5-12-6-7/h1-3,7,12,14H,4-6H2 |
| InChIKey | VRKYKZGLESAHCK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |