C9H8BrNO2 — CID 84703063
1-(7-bromo-1,2-benzoxazol-3-yl)ethanol (PubChem CID 84703063) has the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. Its IUPAC name is 1-(7-bromo-1,2-benzoxazol-3-yl)ethanol.
| Compound Name | 1-(7-bromo-1,2-benzoxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 84703063 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 1-(7-bromo-1,2-benzoxazol-3-yl)ethanol |
| SMILES | CC(O)c1noc2c(Br)cccc12 |
| InChI | InChI=1S/C9H8BrNO2/c1-5(12)8-6-3-2-4-7(10)9(6)13-11-8/h2-5,12H,1H3 |
| InChIKey | QQEGUIZYRTVXNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |