C19H27N3O3S — CID 39111542
butyl 2-[5,6-dimethyl-4-oxo-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidin-3-yl]acetate (PubChem CID 39111542) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is butyl 2-[5,6-dimethyl-4-oxo-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidin-3-yl]acetate.
| Compound Name | butyl 2-[5,6-dimethyl-4-oxo-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidin-3-yl]acetate |
|---|---|
| PubChem CID | 39111542 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | butyl 2-[5,6-dimethyl-4-oxo-2-(pyrrolidin-1-ylmethyl)thieno[2,3-d]pyrimidin-3-yl]acetate |
| SMILES | CCCCOC(=O)Cn1c(CN2CCCC2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C19H27N3O3S/c1-4-5-10-25-16(23)12-22-15(11-21-8-6-7-9-21)20-18-17(19(22)24)13(2)14(3)26-18/h4-12H2,1-3H3 |
| InChIKey | MWARTDNYVTZCAF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|