C28H26N2O3 — CID 3911358
2-(1H-benzimidazol-2-ylmethyl)-2-(4-pentoxyphenyl)indene-1,3-dione (PubChem CID 3911358) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethyl)-2-(4-pentoxyphenyl)indene-1,3-dione.
| Compound Name | 2-(1H-benzimidazol-2-ylmethyl)-2-(4-pentoxyphenyl)indene-1,3-dione |
|---|---|
| PubChem CID | 3911358 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethyl)-2-(4-pentoxyphenyl)indene-1,3-dione |
| SMILES | CCCCCOc1ccc(C2(Cc3nc4ccccc4[nH]3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H26N2O3/c1-2-3-8-17-33-20-15-13-19(14-16-20)28(18-25-29-23-11-6-7-12-24(23)30-25)26(31)21-9-4-5-10-22(21)27(28)32/h4-7,9-16H,2-3,8,17-18H2,1H3,(H,29,30) |
| InChIKey | PVHFLFXXSBCWFA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|