C29H20FNO2 — CID 39114064
[4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2,2-diphenylacetate (PubChem CID 39114064) has the molecular formula C29H20FNO2 and a molecular weight of 433.48 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2,2-diphenylacetate.
| Compound Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 39114064 |
| Molecular Formula | C29H20FNO2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2,2-diphenylacetate |
| SMILES | N#C/C(=C/c1ccc(OC(=O)C(c2ccccc2)c2ccccc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C29H20FNO2/c30-27-14-8-7-13-26(27)24(20-31)19-21-15-17-25(18-16-21)33-29(32)28(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-19,28H/b24-19- |
| InChIKey | FVYZGLIDOUFOMV-CLCOLTQESA-N |
| XLogP | 6.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|