C20H28N6O6S3 — CID 3911515
1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea (PubChem CID 3911515) has the molecular formula C20H28N6O6S3 and a molecular weight of 544.68 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea.
| Compound Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
|---|---|
| PubChem CID | 3911515 |
| Molecular Formula | C20H28N6O6S3 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NNC(=S)Nc1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C20H28N6O6S3/c1-6-25(7-2)35(31,32)19-12-15(26(27)28)9-11-17(19)22-23-20(33)21-18-13-16(10-8-14(18)3)34(29,30)24(4)5/h8-13,22H,6-7H2,1-5H3,(H2,21,23,33) |
| InChIKey | LXCBMFSBFMDFQX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|