About [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate
[3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate (PubChem CID 39115245) has the molecular formula C24H17FN2O3
and a molecular weight of 400.41 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate.
Molecular Properties
| Compound Name | [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate |
| PubChem CID | 39115245 |
| Molecular Formula | C24H17FN2O3 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)CNC(=O)c2ccccc2)c1)c1ccccc1F |
| InChI | InChI=1S/C24H17FN2O3/c25-22-12-5-4-11-21(22)19(15-26)13-17-7-6-10-20(14-17)30-23(28)16-27-24(29)18-8-2-1-3-9-18/h1-14H,16H2,(H,27,29)/b19-13- |
| InChIKey | FGDYXSOMNXJXNH-UYRXBGFRSA-N |
| XLogP | 4.23 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate?
The IUPAC name of [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate (CID 39115245) is [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate.
What is the SMILES notation for [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate?
The canonical SMILES for [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate is N#C/C(=C/c1cccc(OC(=O)CNC(=O)c2ccccc2)c1)c1ccccc1F.
What is the InChIKey of [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate?
The InChIKey is FGDYXSOMNXJXNH-UYRXBGFRSA-N. The full InChI is InChI=1S/C24H17FN2O3/c25-22-12-5-4-11-21(22)19(15-26)13-17-7-6-10-20(14-17)30-23(28)16-27-24(29)18-8-2-1-3-9-18/h1-14H,16H2,(H,27,29)/b19-13-.
What are the key properties of [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate?
[3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate has a molecular weight of 400.41 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenyl] 2-benzamidoacetate is sourced from PubChem (CID 39115245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).