C24H21N3O6S2 — CID 3911565
methyl 2-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3911565) has the molecular formula C24H21N3O6S2 and a molecular weight of 511.58 g/mol. Its IUPAC name is methyl 2-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3911565 |
| Molecular Formula | C24H21N3O6S2 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | methyl 2-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2sc(=Cc3ccc(SCCO)c([N+](=O)[O-])c3)c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C24H21N3O6S2/c1-14-20(23(30)33-2)21(16-6-4-3-5-7-16)26-22(29)19(35-24(26)25-14)13-15-8-9-18(34-11-10-28)17(12-15)27(31)32/h3-9,12-13,21,28H,10-11H2,1-2H3 |
| InChIKey | GHMQCMVFUYBTQW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|