About 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline
3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline (PubChem CID 39120486) has the molecular formula C20H25N5
and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline.
Molecular Properties
| Compound Name | 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
| PubChem CID | 39120486 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
| SMILES | Cc1cccc2nc(-c3cccc(N)c3)c(CN3CCN(C)CC3)n12 |
| InChI | InChI=1S/C20H25N5/c1-15-5-3-8-19-22-20(16-6-4-7-17(21)13-16)18(25(15)19)14-24-11-9-23(2)10-12-24/h3-8,13H,9-12,14,21H2,1-2H3 |
| InChIKey | JMEDOQFXWHRKBN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline?
The IUPAC name of 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline (CID 39120486) is 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline.
What is the SMILES notation for 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline?
The canonical SMILES for 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline is Cc1cccc2nc(-c3cccc(N)c3)c(CN3CCN(C)CC3)n12.
What is the InChIKey of 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline?
The InChIKey is JMEDOQFXWHRKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5/c1-15-5-3-8-19-22-20(16-6-4-7-17(21)13-16)18(25(15)19)14-24-11-9-23(2)10-12-24/h3-8,13H,9-12,14,21H2,1-2H3.
What are the key properties of 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline?
3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline has a molecular weight of 335.45 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline is sourced from PubChem (CID 39120486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).