C20H25N5 — CID 39120486
3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline (PubChem CID 39120486) has the molecular formula C20H25N5 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline.
| Compound Name | 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
|---|---|
| PubChem CID | 39120486 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[5-methyl-3-[(4-methylpiperazin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
| SMILES | Cc1cccc2nc(-c3cccc(N)c3)c(CN3CCN(C)CC3)n12 |
| InChI | InChI=1S/C20H25N5/c1-15-5-3-8-19-22-20(16-6-4-7-17(21)13-16)18(25(15)19)14-24-11-9-23(2)10-12-24/h3-8,13H,9-12,14,21H2,1-2H3 |
| InChIKey | JMEDOQFXWHRKBN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|