C25H24ClN3O7S — CID 3914061
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 3914061) has the molecular formula C25H24ClN3O7S and a molecular weight of 546.00 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 3914061 |
| Molecular Formula | C25H24ClN3O7S |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-chloro-5-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2cc(C)c(C)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H24ClN3O7S/c1-4-28(18-8-6-5-7-9-18)37(34,35)19-10-11-21(26)20(14-19)25(31)36-15-24(30)27-22-12-16(2)17(3)13-23(22)29(32)33/h5-14H,4,15H2,1-3H3,(H,27,30) |
| InChIKey | OIJBSFILMCENAR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|