C19H21N3S — CID 39148235
2-[(2-ethyl-5,6-dimethylbenzimidazol-1-yl)methyl]benzenecarbothioamide (PubChem CID 39148235) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is 2-[(2-ethyl-5,6-dimethylbenzimidazol-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 2-[(2-ethyl-5,6-dimethylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 39148235 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[(2-ethyl-5,6-dimethylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
| SMILES | CCc1nc2cc(C)c(C)cc2n1Cc1ccccc1C(N)=S |
| InChI | InChI=1S/C19H21N3S/c1-4-18-21-16-9-12(2)13(3)10-17(16)22(18)11-14-7-5-6-8-15(14)19(20)23/h5-10H,4,11H2,1-3H3,(H2,20,23) |
| InChIKey | JRGABOIXCGEAMQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|