C20H23N3S — CID 39157838
2-[(5,6-dimethyl-2-propylbenzimidazol-1-yl)methyl]benzenecarbothioamide (PubChem CID 39157838) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-2-propylbenzimidazol-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 2-[(5,6-dimethyl-2-propylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 39157838 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[(5,6-dimethyl-2-propylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
| SMILES | CCCc1nc2cc(C)c(C)cc2n1Cc1ccccc1C(N)=S |
| InChI | InChI=1S/C20H23N3S/c1-4-7-19-22-17-10-13(2)14(3)11-18(17)23(19)12-15-8-5-6-9-16(15)20(21)24/h5-6,8-11H,4,7,12H2,1-3H3,(H2,21,24) |
| InChIKey | HOXVZAIBAORSED-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|