C15H12N2O3 — CID 39158501
6-(phenoxymethyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole (PubChem CID 39158501) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 6-(phenoxymethyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole.
| Compound Name | 6-(phenoxymethyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 39158501 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-(phenoxymethyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole |
| SMILES | c1ccc(OCc2nc3cc4c(cc3[nH]2)OCO4)cc1 |
| InChI | InChI=1S/C15H12N2O3/c1-2-4-10(5-3-1)18-8-15-16-11-6-13-14(20-9-19-13)7-12(11)17-15/h1-7H,8-9H2,(H,16,17) |
| InChIKey | DGMDDMADACPBCU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |