C17H17N3O2 — CID 82336768
N-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-N-ethylaniline (PubChem CID 82336768) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-N-ethylaniline.
| Compound Name | N-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-N-ethylaniline |
|---|---|
| PubChem CID | 82336768 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-N-ethylaniline |
| SMILES | CCN(Cc1nc2cc3c(cc2[nH]1)OCO3)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c1-2-20(12-6-4-3-5-7-12)10-17-18-13-8-15-16(22-11-21-15)9-14(13)19-17/h3-9H,2,10-11H2,1H3,(H,18,19) |
| InChIKey | HPYKXVSLEBTVEV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |