C17H20N2O2 — CID 16786557
1-(1,3-benzodioxol-5-yl)-N'-ethyl-N'-phenylethane-1,2-diamine (PubChem CID 16786557) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N'-ethyl-N'-phenylethane-1,2-diamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N'-ethyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 16786557 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N'-ethyl-N'-phenylethane-1,2-diamine |
| SMILES | CCN(CC(N)c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(14-6-4-3-5-7-14)11-15(18)13-8-9-16-17(10-13)21-12-20-16/h3-10,15H,2,11-12,18H2,1H3 |
| InChIKey | VDKDEKVEXVXOLZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |