C13H9N3O2S2 — CID 39158911
3-[[5-(furan-2-yl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]propanenitrile (PubChem CID 39158911) has the molecular formula C13H9N3O2S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[[5-(furan-2-yl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(furan-2-yl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 39158911 |
| Molecular Formula | C13H9N3O2S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-[[5-(furan-2-yl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nc2scc(-c3ccco3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H9N3O2S2/c14-4-2-6-19-13-15-11(17)10-8(7-20-12(10)16-13)9-3-1-5-18-9/h1,3,5,7H,2,6H2,(H,15,16,17) |
| InChIKey | XFDFUIZYHXZCNU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|