C15H12N4O2S3 — CID 7587928
N-(2-cyanoethyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 7587928) has the molecular formula C15H12N4O2S3 and a molecular weight of 376.49 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7587928 |
| Molecular Formula | C15H12N4O2S3 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-(2-cyanoethyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | N#CCCNC(=O)CSc1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N4O2S3/c16-4-2-5-17-11(20)8-24-15-18-13(21)12-9(7-23-14(12)19-15)10-3-1-6-22-10/h1,3,6-7H,2,5,8H2,(H,17,20)(H,18,19,21) |
| InChIKey | ZOJQSSCBIISKLI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|