C18H21N3O3S3 — CID 24654491
N-(3-ethoxypropyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide (PubChem CID 24654491) has the molecular formula C18H21N3O3S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 24654491 |
| Molecular Formula | C18H21N3O3S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
| SMILES | CCOCCCNC(=O)CSCc1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N3O3S3/c1-2-24-7-4-6-19-15(22)11-25-10-14-20-17(23)16-12(9-27-18(16)21-14)13-5-3-8-26-13/h3,5,8-9H,2,4,6-7,10-11H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | AKBQIVCDKPXWKQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|