C20H15ClN4O3S3 — CID 24654378
2-chloro-N'-[2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetyl]benzohydrazide (PubChem CID 24654378) has the molecular formula C20H15ClN4O3S3 and a molecular weight of 491.02 g/mol. Its IUPAC name is 2-chloro-N'-[2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24654378 |
| Molecular Formula | C20H15ClN4O3S3 |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 2-chloro-N'-[2-[(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSCc1nc2scc(-c3cccs3)c2c(=O)[nH]1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H15ClN4O3S3/c21-13-5-2-1-4-11(13)18(27)25-24-16(26)10-29-9-15-22-19(28)17-12(8-31-20(17)23-15)14-6-3-7-30-14/h1-8H,9-10H2,(H,24,26)(H,25,27)(H,22,23,28) |
| InChIKey | GCLJDOBBJSSAOX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|