C17H18N2OS2 — CID 39159104
2-[(2-carbamothioylphenyl)methylsulfanyl]-N-(4-methylphenyl)acetamide (PubChem CID 39159104) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2-[(2-carbamothioylphenyl)methylsulfanyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-carbamothioylphenyl)methylsulfanyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 39159104 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[(2-carbamothioylphenyl)methylsulfanyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSCc2ccccc2C(N)=S)cc1 |
| InChI | InChI=1S/C17H18N2OS2/c1-12-6-8-14(9-7-12)19-16(20)11-22-10-13-4-2-3-5-15(13)17(18)21/h2-9H,10-11H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | JNKHGYMQXCELJC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|