C15H19N3O3 — CID 39161811
7-methyl-4-(2-oxo-2-piperazin-1-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 39161811) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 7-methyl-4-(2-oxo-2-piperazin-1-ylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 7-methyl-4-(2-oxo-2-piperazin-1-ylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 39161811 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 7-methyl-4-(2-oxo-2-piperazin-1-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)OCC(=O)N2CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-2-3-12-13(8-11)21-10-15(20)18(12)9-14(19)17-6-4-16-5-7-17/h2-3,8,16H,4-7,9-10H2,1H3 |
| InChIKey | UCEBKJNEDULRCK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |