C18H26N4O3 — CID 39163327
N,N-diethyl-2-(3-oxo-7-piperazin-1-yl-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39163327) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N,N-diethyl-2-(3-oxo-7-piperazin-1-yl-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N,N-diethyl-2-(3-oxo-7-piperazin-1-yl-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39163327 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N,N-diethyl-2-(3-oxo-7-piperazin-1-yl-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)COc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C18H26N4O3/c1-3-20(4-2)17(23)12-22-15-6-5-14(21-9-7-19-8-10-21)11-16(15)25-13-18(22)24/h5-6,11,19H,3-4,7-10,12-13H2,1-2H3 |
| InChIKey | JWIWHOQXBLZEGR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |