C16H21N5O4 — CID 39163407
N'-acetyl-2-(3-oxo-6-piperazin-1-yl-1,4-benzoxazin-4-yl)acetohydrazide (PubChem CID 39163407) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is N'-acetyl-2-(3-oxo-6-piperazin-1-yl-1,4-benzoxazin-4-yl)acetohydrazide.
| Compound Name | N'-acetyl-2-(3-oxo-6-piperazin-1-yl-1,4-benzoxazin-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 39163407 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N'-acetyl-2-(3-oxo-6-piperazin-1-yl-1,4-benzoxazin-4-yl)acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN1C(=O)COc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C16H21N5O4/c1-11(22)18-19-15(23)9-21-13-8-12(20-6-4-17-5-7-20)2-3-14(13)25-10-16(21)24/h2-3,8,17H,4-7,9-10H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | HVWWVYYLVNSTKU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|