C14H10Br2N2O4 — CID 39166885
N-(2,5-dibromophenyl)-2-(2-nitrophenoxy)acetamide (PubChem CID 39166885) has the molecular formula C14H10Br2N2O4 and a molecular weight of 430.05 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(2,5-dibromophenyl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 39166885 |
| Molecular Formula | C14H10Br2N2O4 |
| Molecular Weight | 430.05 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | N-(2,5-dibromophenyl)-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H10Br2N2O4/c15-9-5-6-10(16)11(7-9)17-14(19)8-22-13-4-2-1-3-12(13)18(20)21/h1-7H,8H2,(H,17,19) |
| InChIKey | ZFCNBUKACUMHPX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|