C12H9ClN2O2S — CID 39170420
N-(4-carbamoyl-3-chlorophenyl)thiophene-3-carboxamide (PubChem CID 39170420) has the molecular formula C12H9ClN2O2S and a molecular weight of 280.74 g/mol. Its IUPAC name is N-(4-carbamoyl-3-chlorophenyl)thiophene-3-carboxamide.
| Compound Name | N-(4-carbamoyl-3-chlorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 39170420 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N-(4-carbamoyl-3-chlorophenyl)thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2ccsc2)cc1Cl |
| InChI | InChI=1S/C12H9ClN2O2S/c13-10-5-8(1-2-9(10)11(14)16)15-12(17)7-3-4-18-6-7/h1-6H,(H2,14,16)(H,15,17) |
| InChIKey | JRRKNISENIUQLK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |