C20H18F3N3O2 — CID 39189099
(2R)-2-phenoxy-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide (PubChem CID 39189099) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is (2R)-2-phenoxy-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R)-2-phenoxy-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 39189099 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2R)-2-phenoxy-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)Nc1ccc(-n2cccn2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H18F3N3O2/c1-2-18(28-15-7-4-3-5-8-15)19(27)25-17-10-9-14(26-12-6-11-24-26)13-16(17)20(21,22)23/h3-13,18H,2H2,1H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | GGXNOYPLRJIIIJ-GOSISDBHSA-N |
| XLogP | 4.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |