C22H24F3N5O — CID 47033764
1-benzyl-1-[2-(dimethylamino)ethyl]-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]urea (PubChem CID 47033764) has the molecular formula C22H24F3N5O and a molecular weight of 431.46 g/mol. Its IUPAC name is 1-benzyl-1-[2-(dimethylamino)ethyl]-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-[2-(dimethylamino)ethyl]-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 47033764 |
| Molecular Formula | C22H24F3N5O |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-benzyl-1-[2-(dimethylamino)ethyl]-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)Nc1ccc(-n2cccn2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N5O/c1-28(2)13-14-29(16-17-7-4-3-5-8-17)21(31)27-20-10-9-18(30-12-6-11-26-30)15-19(20)22(23,24)25/h3-12,15H,13-14,16H2,1-2H3,(H,27,31) |
| InChIKey | NCYJYBZXUMXUSI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |