C17H11ClF2N2OS — CID 39189888
2-chloro-4,5-difluoro-N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 39189888) has the molecular formula C17H11ClF2N2OS and a molecular weight of 364.80 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 39189888 |
| Molecular Formula | C17H11ClF2N2OS |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1nc(NC(=O)c2cc(F)c(F)cc2Cl)sc1-c1ccccc1 |
| InChI | InChI=1S/C17H11ClF2N2OS/c1-9-15(10-5-3-2-4-6-10)24-17(21-9)22-16(23)11-7-13(19)14(20)8-12(11)18/h2-8H,1H3,(H,21,22,23) |
| InChIKey | INEIWXAZXSQTOZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|