C13H10N2O2S2 — CID 39196288
(E)-3-(6-methyl-3-thiophen-2-ylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid (PubChem CID 39196288) has the molecular formula C13H10N2O2S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (E)-3-(6-methyl-3-thiophen-2-ylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-methyl-3-thiophen-2-ylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 39196288 |
| Molecular Formula | C13H10N2O2S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (E)-3-(6-methyl-3-thiophen-2-ylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid |
| SMILES | Cc1nc2scc(-c3cccs3)n2c1/C=C/C(=O)O |
| InChI | InChI=1S/C13H10N2O2S2/c1-8-9(4-5-12(16)17)15-10(7-19-13(15)14-8)11-3-2-6-18-11/h2-7H,1H3,(H,16,17)/b5-4+ |
| InChIKey | DGVXMQPOTBXWSH-SNAWJCMRSA-N |
| XLogP | 3.53 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|