C20H15ClN2OS — CID 39198378
3-(4-chlorophenyl)-2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198378) has the molecular formula C20H15ClN2OS and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(4-chlorophenyl)-2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198378 |
| Molecular Formula | C20H15ClN2OS |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3-(4-chlorophenyl)-2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1ccc(-c2nc3sc(C)c(-c4ccc(Cl)cc4)n3c2C=O)cc1 |
| InChI | InChI=1S/C20H15ClN2OS/c1-12-3-5-14(6-4-12)18-17(11-24)23-19(13(2)25-20(23)22-18)15-7-9-16(21)10-8-15/h3-11H,1-2H3 |
| InChIKey | QPTLFANFAGWWBK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|