C17H15ClN2OS — CID 82036084
2-(4-chlorophenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde (PubChem CID 82036084) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde |
|---|---|
| PubChem CID | 82036084 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde |
| SMILES | CC1CCc2c(sc3nc(-c4ccc(Cl)cc4)c(C=O)n23)C1 |
| InChI | InChI=1S/C17H15ClN2OS/c1-10-2-7-13-15(8-10)22-17-19-16(14(9-21)20(13)17)11-3-5-12(18)6-4-11/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | RABJIZJYRVNGEY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|