C22H26N2OS — CID 82036144
6-tert-butyl-2-(2,4-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde (PubChem CID 82036144) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,4-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde.
| Compound Name | 6-tert-butyl-2-(2,4-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde |
|---|---|
| PubChem CID | 82036144 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 6-tert-butyl-2-(2,4-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carbaldehyde |
| SMILES | Cc1ccc(-c2nc3sc4c(n3c2C=O)CCC(C(C)(C)C)C4)c(C)c1 |
| InChI | InChI=1S/C22H26N2OS/c1-13-6-8-16(14(2)10-13)20-18(12-25)24-17-9-7-15(22(3,4)5)11-19(17)26-21(24)23-20/h6,8,10,12,15H,7,9,11H2,1-5H3 |
| InChIKey | QDCZQWKJKKAUJA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|