C15H12N2O3S — CID 39199065
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39199065) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39199065 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1sc2ncc(C=O)n2c1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H12N2O3S/c1-9-14(17-11(8-18)7-16-15(17)21-9)10-2-3-12-13(6-10)20-5-4-19-12/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | VJEVKVOUWZWIMW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|