C12H14N2OS — CID 39205098
N-methyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]aniline (PubChem CID 39205098) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is N-methyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]aniline.
| Compound Name | N-methyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 39205098 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-methyl-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]aniline |
| SMILES | CNc1ccc(OCc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C12H14N2OS/c1-9-8-16-12(14-9)7-15-11-5-3-10(13-2)4-6-11/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | BGJVHAVZRPIZOT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|