C27H20Cl2FN3O4 — CID 3921805
[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 3921805) has the molecular formula C27H20Cl2FN3O4 and a molecular weight of 540.38 g/mol. Its IUPAC name is [2-(5-chloro-2-phenoxyanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(5-chloro-2-phenoxyanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3921805 |
| Molecular Formula | C27H20Cl2FN3O4 |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | [2-(5-chloro-2-phenoxyanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C=CC(=O)OCC(=O)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C27H20Cl2FN3O4/c1-17-22(27(29)33(32-17)20-10-8-19(30)9-11-20)12-14-26(35)36-16-25(34)31-23-15-18(28)7-13-24(23)37-21-5-3-2-4-6-21/h2-15H,16H2,1H3,(H,31,34) |
| InChIKey | YTSKQKHKKUKANF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|