C23H21ClFN3O5 — CID 2499497
[2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 2499497) has the molecular formula C23H21ClFN3O5 and a molecular weight of 473.89 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2499497 |
| Molecular Formula | C23H21ClFN3O5 |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1cc(NC(=O)COC(=O)/C=C/c2c(C)nn(-c3ccc(F)cc3)c2Cl)cc(OC)c1 |
| InChI | InChI=1S/C23H21ClFN3O5/c1-14-20(23(24)28(27-14)17-6-4-15(25)5-7-17)8-9-22(30)33-13-21(29)26-16-10-18(31-2)12-19(11-16)32-3/h4-12H,13H2,1-3H3,(H,26,29)/b9-8+ |
| InChIKey | DGFNHDDUUWDBPE-CMDGGOBGSA-N |
| XLogP | 4.19 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|