C22H17ClFN3O5 — CID 4856249
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4856249) has the molecular formula C22H17ClFN3O5 and a molecular weight of 457.85 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4856249 |
| Molecular Formula | C22H17ClFN3O5 |
| Molecular Weight | 457.85 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C=CC(=O)OCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H17ClFN3O5/c1-13-17(22(23)27(26-13)16-5-2-14(24)3-6-16)7-9-21(29)30-11-20(28)25-15-4-8-18-19(10-15)32-12-31-18/h2-10H,11-12H2,1H3,(H,25,28) |
| InChIKey | QETLUJZEQFJKLB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|