C29H29NO5 — CID 3922089
methyl 4-[[4-[[2-(1-adamantyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 3922089) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl 4-[[4-[[2-(1-adamantyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[[2-(1-adamantyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 3922089 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | methyl 4-[[4-[[2-(1-adamantyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C3N=C(C45CC6CC(CC(C6)C4)C5)OC3=O)cc2)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-33-26(31)23-6-2-19(3-7-23)17-34-24-8-4-18(5-9-24)13-25-27(32)35-28(30-25)29-14-20-10-21(15-29)12-22(11-20)16-29/h2-9,13,20-22H,10-12,14-17H2,1H3 |
| InChIKey | FDAKMUHGAIRAMY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|