C23H27NO4 — CID 6055253
(4E)-2-(1-adamantyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6055253) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (4E)-2-(1-adamantyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(1-adamantyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6055253 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (4E)-2-(1-adamantyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(/C=C2/N=C(C34CC5CC(CC(C5)C3)C4)OC2=O)cc1OC |
| InChI | InChI=1S/C23H27NO4/c1-3-27-19-5-4-14(10-20(19)26-2)9-18-21(25)28-22(24-18)23-11-15-6-16(12-23)8-17(7-15)13-23/h4-5,9-10,15-17H,3,6-8,11-13H2,1-2H3/b18-9+ |
| InChIKey | RXLYMOASXBEEKX-GIJQJNRQSA-N |
| XLogP | 4.61 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|