C17H18N4O2 — CID 39222393
[3,4-dimethoxy-5-(5-pyridin-3-yl-1H-pyrazol-4-yl)phenyl]methanamine (PubChem CID 39222393) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is [3,4-dimethoxy-5-(5-pyridin-3-yl-1H-pyrazol-4-yl)phenyl]methanamine.
| Compound Name | [3,4-dimethoxy-5-(5-pyridin-3-yl-1H-pyrazol-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 39222393 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [3,4-dimethoxy-5-(5-pyridin-3-yl-1H-pyrazol-4-yl)phenyl]methanamine |
| SMILES | COc1cc(CN)cc(-c2cn[nH]c2-c2cccnc2)c1OC |
| InChI | InChI=1S/C17H18N4O2/c1-22-15-7-11(8-18)6-13(17(15)23-2)14-10-20-21-16(14)12-4-3-5-19-9-12/h3-7,9-10H,8,18H2,1-2H3,(H,20,21) |
| InChIKey | FPUJSZVHYYZLID-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |