C25H28N4O2 — CID 39235528
N-[4-oxo-4-[(5-piperidin-1-ylisoquinolin-8-yl)amino]butyl]benzamide (PubChem CID 39235528) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[4-oxo-4-[(5-piperidin-1-ylisoquinolin-8-yl)amino]butyl]benzamide.
| Compound Name | N-[4-oxo-4-[(5-piperidin-1-ylisoquinolin-8-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 39235528 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[4-oxo-4-[(5-piperidin-1-ylisoquinolin-8-yl)amino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)Nc1ccc(N2CCCCC2)c2ccncc12 |
| InChI | InChI=1S/C25H28N4O2/c30-24(10-7-14-27-25(31)19-8-3-1-4-9-19)28-22-11-12-23(29-16-5-2-6-17-29)20-13-15-26-18-21(20)22/h1,3-4,8-9,11-13,15,18H,2,5-7,10,14,16-17H2,(H,27,31)(H,28,30) |
| InChIKey | KXWRNZFRCCXCGV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|