C29H26N4O2 — CID 55501395
2-(9-oxoacridin-10-yl)-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide (PubChem CID 55501395) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide.
| Compound Name | 2-(9-oxoacridin-10-yl)-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide |
|---|---|
| PubChem CID | 55501395 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)-N-(5-piperidin-1-ylisoquinolin-8-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)Nc1ccc(N2CCCCC2)c2ccncc12 |
| InChI | InChI=1S/C29H26N4O2/c34-28(19-33-26-10-4-2-8-21(26)29(35)22-9-3-5-11-27(22)33)31-24-12-13-25(32-16-6-1-7-17-32)20-14-15-30-18-23(20)24/h2-5,8-15,18H,1,6-7,16-17,19H2,(H,31,34) |
| InChIKey | OFIKTMVSNUIHLE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|