C25H30N4O5S — CID 3924257
4-methoxy-3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 3924257) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-methoxy-3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-methoxy-3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 3924257 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-methoxy-3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1cccc(Cc2nsc(Oc3cc(C(=O)NCCCN4CCOCC4)ccc3OC)n2)c1 |
| InChI | InChI=1S/C25H30N4O5S/c1-31-20-6-3-5-18(15-20)16-23-27-25(35-28-23)34-22-17-19(7-8-21(22)32-2)24(30)26-9-4-10-29-11-13-33-14-12-29/h3,5-8,15,17H,4,9-14,16H2,1-2H3,(H,26,30) |
| InChIKey | QGEXXSGKYGBCHX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|