C24H28N4O3S — CID 5028109
2-[4-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 5028109) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[4-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[4-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 5028109 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[4-[(3-benzyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(Cc1ccc(Oc2nc(Cc3ccccc3)ns2)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H28N4O3S/c29-23(25-11-4-12-28-13-15-30-16-14-28)18-20-7-9-21(10-8-20)31-24-26-22(27-32-24)17-19-5-2-1-3-6-19/h1-3,5-10H,4,11-18H2,(H,25,29) |
| InChIKey | CQQBXLSFTCXSOH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|