C21H13Cl2F2NO4 — CID 3925048
bis[(2-chloro-6-fluorophenyl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 3925048) has the molecular formula C21H13Cl2F2NO4 and a molecular weight of 452.24 g/mol. Its IUPAC name is bis[(2-chloro-6-fluorophenyl)methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(2-chloro-6-fluorophenyl)methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 3925048 |
| Molecular Formula | C21H13Cl2F2NO4 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | bis[(2-chloro-6-fluorophenyl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | O=C(OCc1c(F)cccc1Cl)c1cccc(C(=O)OCc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C21H13Cl2F2NO4/c22-14-4-1-6-16(24)12(14)10-29-20(27)18-8-3-9-19(26-18)21(28)30-11-13-15(23)5-2-7-17(13)25/h1-9H,10-11H2 |
| InChIKey | JSEACNHEEJMDAK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |