C20H20IN3O — CID 3925288
3-(2-iodophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 3925288) has the molecular formula C20H20IN3O and a molecular weight of 445.30 g/mol. Its IUPAC name is 3-(2-iodophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 3-(2-iodophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 3925288 |
| Molecular Formula | C20H20IN3O |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 3-(2-iodophenyl)-1-(4-methoxyphenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | COc1ccc(-n2nc(-c3ccccc3I)c3c2NCCCC3)cc1 |
| InChI | InChI=1S/C20H20IN3O/c1-25-15-11-9-14(10-12-15)24-20-17(7-4-5-13-22-20)19(23-24)16-6-2-3-8-18(16)21/h2-3,6,8-12,22H,4-5,7,13H2,1H3 |
| InChIKey | YWWZJXMJNPGEFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|